For research use only. Not for therapeutic Use.
2-Ethylhexylglucopyranoside (Cat No.:M118212) is a chemical compound. It features a glucose unit linked to an octyl (2-ethylhexyl) group. This compound is valuable in various industries, particularly in cosmetics, pharmaceuticals, and biotechnology. It is widely used as a nonionic surfactant and solubilizing agent due to its amphiphilic nature. 2-Ethylhexylglucopyranoside enhances the solubility of hydrophobic compounds and aids in the formulation of stable emulsions and solutions. Its role in enhancing the stability and performance of products like lotions, creams, and detergents contributes to its significance in the development of effective and well-tolerated formulations.
| Catalog Number | M118212 |
| CAS Number | 125590-73-0 |
| Molecular Formula | C14H28O6 |
| Purity | ≥95% |
| Storage | Store at RT |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-(2-ethylhexoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
| InChI | InChI=1S/C14H28O6/c1-3-5-6-9(4-2)8-19-14-13(18)12(17)11(16)10(7-15)20-14/h9-18H,3-8H2,1-2H3/t9?,10-,11-,12+,13-,14+/m1/s1 |
| InChIKey | FYYKJKKBDPRFJO-IZVWSYFDSA-N |
| SMILES | CCCCC(CC)COC1C(C(C(C(O1)CO)O)O)O |
