For research use only. Not for therapeutic Use.
2-Ethynyl-3-methylthiophene(Cat No.:L006790). It features a thiophene ring (a five-membered aromatic ring containing sulfur) substituted with an ethynyl group (-C≡CH) at the 2-position and a methyl group (-CH3) at the 3-position. This compound is significant in organic synthesis and material science, often utilized as a building block for the synthesis of various organic molecules and polymers. Its unique structure imparts specific chemical reactivity, making it valuable for creating specialized chemicals, pharmaceuticals, and advanced materials such as conducting polymers and organic semiconductors.
CAS Number | 81294-11-3 |
Molecular Formula | C7H6S |
Purity | ≥95% |
IUPAC Name | 2-ethynyl-3-methylthiophene |
InChI | InChI=1S/C7H6S/c1-3-7-6(2)4-5-8-7/h1,4-5H,2H3 |
InChIKey | OXECOAGMUUJLPS-UHFFFAOYSA-N |
SMILES | CC1=C(SC=C1)C#C |