2-Ethynyl-4,6-dimethylpyrimidine(CAT: L000475) is a compound of significance in organic chemistry, particularly as a key intermediate in the synthesis of various organic molecules. This compound finds applications in different fields, including pharmaceutical, agrochemical, and material chemistry. Its unique structure and reactivity make it a valuable building block for chemists and researchers, enabling the creation of a wide range of organic compounds for diverse purposes.
Catalog Number | L000475 |
CAS Number | 86520-99-2 |
Molecular Formula | C8H8N2 |
Purity | ≥95% |
IUPAC Name | 2-ethynyl-4,6-dimethylpyrimidine |
InChI | InChI=1S/C8H8N2/c1-4-8-9-6(2)5-7(3)10-8/h1,5H,2-3H3 |
InChIKey | VGWRJXCDOHBOSC-UHFFFAOYSA-N |