For research use only. Not for therapeutic Use.
2′-Fluoro-2′-deoxyuridine(Cat No.:R050790)is a potent nucleoside analog used in cancer research and antiviral studies. It is structurally similar to thymidine, with a fluorine atom replacing the hydrogen at the 2′ position of the deoxyribose ring. This modification enhances its stability and incorporation into DNA during replication. As a thymidylate synthase inhibitor, it disrupts DNA synthesis, showing potential as an antimetabolite in chemotherapy. Its selective targeting of rapidly proliferating cells makes it a valuable tool in investigating cancer therapies and antiviral agents, particularly in nucleotide metabolism research.
CAS Number | 784-71-4 |
Synonyms | 2’-Deoxy-2’-fluorouridine; Fioluridine |
Molecular Formula | C9H11FN2O5 |
Purity | ≥95% |
Target | Influenza Virus |
Storage | -20°C |
IUPAC Name | 1-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
InChI | InChI=1S/C9H11FN2O5/c10-6-7(15)4(3-13)17-8(6)12-2-1-5(14)11-9(12)16/h1-2,4,6-8,13,15H,3H2,(H,11,14,16)/t4-,6-,7-,8-/m1/s1 |
InChIKey | UIYWFOZZIZEEKJ-XVFCMESISA-N |
SMILES | C1=CN(C(=O)NC1=O)[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)F |