Home
>
Chemical Reagents>Organometallic Reagents> 2-Fluoro-3-isopropoxyphenylboronic acid pinacol ester
For research use only. Not for therapeutic Use.
2-Fluoro-3-isopropoxyphenylboronic acid pinacol ester (Cat.No:L003616) is a crucial chemical compound widely employed in organic synthesis. Its unique boronic acid motif, combined with the pinacol ester functionality, makes it a versatile building block in the preparation of various pharmaceutical agents and specialized materials.
CAS Number | 1451391-00-6 |
Molecular Formula | C15H22BFO3 |
Purity | ≥95% |
IUPAC Name | 2-(2-fluoro-3-propan-2-yloxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
InChI | InChI=1S/C15H22BFO3/c1-10(2)18-12-9-7-8-11(13(12)17)16-19-14(3,4)15(5,6)20-16/h7-10H,1-6H3 |
InChIKey | DSIBMZWYVMJDAZ-UHFFFAOYSA-N |
SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC=C2)OC(C)C)F |