For research use only. Not for therapeutic Use.
2-Fluoro-4-(1H-tetrazol-5-yl)benzoic acid(CAT: L000365) is a valuable compound with diverse applications in pharmaceutical chemistry. Its core tetrazole ring structure is a crucial pharmacophore often found in drug design. This molecule can serve as a key building block for the synthesis of pharmaceutical agents, especially those targeting specific biological receptors or enzymes. The introduction of a fluoro group enhances its bioactivity and metabolic stability, making it a promising candidate for drug development.
CAS Number | 1281983-77-4 |
Molecular Formula | C8H5FN4O2 |
Purity | ≥95% |
IUPAC Name | 2-fluoro-4-(2H-tetrazol-5-yl)benzoic acid |
InChI | InChI=1S/C8H5FN4O2/c9-6-3-4(7-10-12-13-11-7)1-2-5(6)8(14)15/h1-3H,(H,14,15)(H,10,11,12,13) |
InChIKey | WZADURDEXDTRDQ-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |