For research use only. Not for therapeutic Use.
2-Fluoro-4-iodo-1-nitrobenzene is an aromatic compound characterized by a fluorine atom at the 2-position, an iodine atom at the 4-position, and a nitro group at the 1-position of a benzene ring. This compound is significant in organic synthesis and medicinal chemistry due to its potential biological activities and applications in the development of pharmaceuticals. The presence of both halogens and a nitro group enhances its reactivity, making it a valuable intermediate for further chemical transformations and functionalization in drug discovery.
CAS Number | 2996-31-8 |
Molecular Formula | C6H3FINO2 |
Purity | ≥95% |
IUPAC Name | 2-fluoro-4-iodo-1-nitrobenzene |
InChI | InChI=1S/C6H3FINO2/c7-5-3-4(8)1-2-6(5)9(10)11/h1-3H |
InChIKey | UVJQZMONVWFIHE-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1I)F)[N+](=O)[O-] |