For research use only. Not for therapeutic Use.
2-Fluoro-4-iodoaniline (Cat No.:R060326) is an organic compound with the formula C6H5FIN. It is an aniline derivative, containing both fluorine and iodine atoms attached to the aromatic ring. This compound serves as a versatile building block in organic synthesis, enabling the preparation of various compounds, including pharmaceuticals and agrochemicals. Its unique combination of fluorine and iodine atoms provides versatility in chemical reactions, making it an important intermediate for the development of novel molecules and functional materials in various research and industrial applications.
CAS Number | 29632-74-4 |
Synonyms | 2-Fluoro-4-iodobenzenamine; 2-Fluoro-4-iodobenzenamine; 2-Fluoro-4-iodophenylamine; 4-Iodo-2-fluoroaniline; NSC 146507 |
Molecular Formula | C6H5FIN |
Purity | ≥95% |
Storage | RT |
IUPAC Name | 2-fluoro-4-iodoaniline |
InChI | InChI=1S/C6H5FIN/c7-5-3-4(8)1-2-6(5)9/h1-3H,9H2 |
InChIKey | CUMTUBVTKOYYOU-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1I)F)N |