For research use only. Not for therapeutic Use.
2-Fluoro-4-methylbenzenesulfinic acid sodium salt(Cat No.:L007554), is a chemical compound featuring a sulfinic acid group attached to a 2-fluoro-4-methylbenzene ring and stabilized as a sodium salt. This compound holds significance in organic synthesis and chemical research, often utilized as a key reagent for various transformations in the preparation of specialized organic molecules. Its unique structure and reactivity make it valuable for chemical processes, enabling the creation of diverse organic compounds.
CAS Number | 1233501-71-7 |
Molecular Formula | C7H6FNaO2S |
Purity | ≥95% |
IUPAC Name | sodium;2-fluoro-4-methylbenzenesulfinate |
InChI | InChI=1S/C7H7FO2S.Na/c1-5-2-3-7(11(9)10)6(8)4-5;/h2-4H,1H3,(H,9,10);/q;+1/p-1 |
InChIKey | MVVALZZQLFDKEP-UHFFFAOYSA-M |
SMILES | CC1=CC(=C(C=C1)S(=O)[O-])F.[Na+] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |