Home
>
Inhibitors/Agonists>Endocrinology and Hormones>Other Inhibitors> 2-Fluoro-4-(piperidin-4-yl)phenol hydrochloride
For research use only. Not for therapeutic Use.
2-Fluoro-4-(piperidin-4-yl)phenol hydrochloride(CAT: L005313), a piperidine derivative, holds significance in pharmaceutical and organic chemistry. Its aromatic fluorine substitution can influence pharmacological properties, potentially enhancing interactions with specific receptors. In pharmaceutical research, it could serve as a key intermediate for drug development targeting neurological or physiological processes. Its piperidinyl group contributes to its structural diversity, valuable for constructing complex molecules. The hydrochloride salt form ensures solubility and stability in aqueous environments.
CAS Number | 2140866-92-6 |
Molecular Formula | C11H15ClFNO |
Purity | ≥95% |
IUPAC Name | 2-fluoro-4-piperidin-4-ylphenol;hydrochloride |
InChI | InChI=1S/C11H14FNO.ClH/c12-10-7-9(1-2-11(10)14)8-3-5-13-6-4-8;/h1-2,7-8,13-14H,3-6H2;1H |
InChIKey | GNIFGKPMCSEILG-UHFFFAOYSA-N |