For research use only. Not for therapeutic Use.
2-Fluoro-4-vinylpyridine(CAT: L040739) is a high-purity fluorinated pyridine derivative with a vinyl functional group, making it an essential building block in advanced chemical and pharmaceutical research. Its unique structure combines the reactivity of the vinyl group with the electronic effects of the fluorinated pyridine ring, enabling its use in polymer synthesis, cross-coupling reactions, and the development of bioactive compounds. This compound is ideal for applications in material science and medicinal chemistry. With consistent quality and excellent reactivity, 2-Fluoro-4-vinylpyridine supports innovative research and precision-oriented chemical development.
CAS Number | 552331-57-4 |
Molecular Formula | C7H6FN |
Purity | ≥95% |
IUPAC Name | 4-ethenyl-2-fluoropyridine |
InChI | InChI=1S/C7H6FN/c1-2-6-3-4-9-7(8)5-6/h2-5H,1H2 |
InChIKey | WGVZHCAJTSCUEO-UHFFFAOYSA-N |
SMILES | C=CC1=CC(=NC=C1)F |