For research use only. Not for therapeutic Use.
(2-Fluoro-5-(methyl carbamoyl)phenyl)boronic acid(Cat No.:L007326) is a vital compound in organic synthesis. As a boronic acid derivative, it is a key reagent in Suzuki-Miyaura cross-coupling reactions, enabling the formation of complex organic molecules. This compound features a boronic acid group (B(OH)₂) attached to a phenyl ring carrying a fluorine atom and a methylcarbamoyl group. Its significance lies in its utility in medicinal chemistry, drug discovery, and various other research areas where precise carbon-carbon bond formations are crucial.
CAS Number | 874289-40-4 |
Molecular Formula | C8H9BFNO3 |
Purity | ≥95% |
IUPAC Name | [2-fluoro-5-(methylcarbamoyl)phenyl]boronic acid |
InChI | InChI=1S/C8H9BFNO3/c1-11-8(12)5-2-3-7(10)6(4-5)9(13)14/h2-4,13-14H,1H3,(H,11,12) |
InChIKey | YOQRSSHEHKHAGS-UHFFFAOYSA-N |
SMILES | B(C1=C(C=CC(=C1)C(=O)NC)F)(O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |