For research use only. Not for therapeutic Use.
2-Fluoro-5-[methyl(propane-2-yl)sulfamoyl]benzoic acid(Cat No.:L007708), is a chemical compound featuring a benzoic acid core with a fluorine atom and a sulfamoyl group attached to the aromatic ring. This specific molecular structure is essential in medicinal chemistry and organic synthesis. Researchers use it as a versatile building block for the synthesis of diverse organic molecules, especially in the development of pharmaceuticals. Its applications extend to drug discovery, where it serves as a key intermediate in the creation of potential therapeutic agents.
CAS Number | 926191-54-0 |
Molecular Formula | C11H14FNO4S |
Purity | ≥95% |
IUPAC Name | 2-fluoro-5-[methyl(propan-2-yl)sulfamoyl]benzoic acid |
InChI | InChI=1S/C11H14FNO4S/c1-7(2)13(3)18(16,17)8-4-5-10(12)9(6-8)11(14)15/h4-7H,1-3H3,(H,14,15) |
InChIKey | QMNPHSRUPNIRLX-UHFFFAOYSA-N |
SMILES | CC(C)N(C)S(=O)(=O)C1=CC(=C(C=C1)F)C(=O)O |