For research use only. Not for therapeutic Use.
2-Fluoro-6-methylpyridin-4-amine(Cat No.:L023883)is an important compound used in pharmaceutical research and organic synthesis. Featuring a fluorine atom, a methyl group, and an amine group on a pyridine ring, this compound serves as a key intermediate in the development of various bioactive molecules, including potential drug candidates. Its structure allows for selective reactivity, making it valuable in the synthesis of complex heterocyclic compounds. High purity and stability ensure consistent performance in research applications, supporting advanced medicinal chemistry efforts and the discovery of innovative therapeutic agents.
CAS Number | 1622844-16-9 |
Molecular Formula | C6H7FN2 |
Purity | ≥95% |
IUPAC Name | 2-fluoro-6-methylpyridin-4-amine |
InChI | InChI=1S/C6H7FN2/c1-4-2-5(8)3-6(7)9-4/h2-3H,1H3,(H2,8,9) |
InChIKey | PAGKNUKVUUSYPM-UHFFFAOYSA-N |
SMILES | CC1=CC(=CC(=N1)F)N |