For research use only. Not for therapeutic Use.
2-Fluoro-6-nitropyridine(Cat No.:L019704)is a crucial compound in pharmaceutical research and organic synthesis, featuring both a fluorine atom and a nitro group on a pyridine ring. This combination of functional groups makes it a valuable intermediate in the synthesis of complex bioactive molecules, including potential therapeutic agents. Its unique reactivity allows for targeted chemical transformations, particularly in the development of pharmaceuticals and agrochemicals. With high purity and stability, 2-Fluoro-6-nitropyridine is essential for advancing medicinal chemistry and innovative research in drug discovery and chemical synthesis.
CAS Number | 1082042-27-0 |
Molecular Formula | C5H3FN2O2 |
Purity | ≥95% |
IUPAC Name | 2-fluoro-6-nitropyridine |
InChI | InChI=1S/C5H3FN2O2/c6-4-2-1-3-5(7-4)8(9)10/h1-3H |
InChIKey | OCOVUZVTOYAYHB-UHFFFAOYSA-N |
SMILES | C1=CC(=NC(=C1)F)[N+](=O)[O-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |