For research use only. Not for therapeutic Use.
2-Fluoro-9-β-D-(2′,3′,5′-tri-O-acetyl arabinofuranosyl)-adenine(Cat No.:M036880)is a specialized nucleoside analog widely used in pharmaceutical research, particularly in antiviral and anticancer drug development. This compound features a fluorinated adenine base attached to an acetyl-protected arabinofuranosyl sugar, making it a crucial intermediate in the synthesis of modified nucleotides. Its unique structure allows for targeted interactions with biological systems, enhancing its therapeutic potential. 2-Fluoro-9-β-D-(2′,3′,5′-tri-O-acetyl arabinofuranosyl)-adenine plays a significant role in advancing medicinal chemistry and the development of innovative therapies.
Catalog Number | M036880 |
CAS Number | 161109-77-9 |
Synonyms | 2-Fluoro-9-β-D-(2′,3′,5′-tri-O-acetyl arabinofuranosyl)-adenine |
Molecular Formula | C16H18FN5O7 |
Purity | ≥95% |
IUPAC Name | [(2R,3R,4S,5R)-3,4-diacetyloxy-5-(6-amino-2-fluoropurin-9-yl)oxolan-2-yl]methyl acetate |
InChI | InChI=1S/C16H18FN5O7/c1-6(23)26-4-9-11(27-7(2)24)12(28-8(3)25)15(29-9)22-5-19-10-13(18)20-16(17)21-14(10)22/h5,9,11-12,15H,4H2,1-3H3,(H2,18,20,21)/t9-,11-,12+,15-/m1/s1 |
InChIKey | LDICZLRLPNWOIS-ADGXKJENSA-N |
SMILES | CC(=O)OCC1C(C(C(O1)N2C=NC3=C(N=C(N=C32)F)N)OC(=O)C)OC(=O)C |