For research use only. Not for therapeutic Use.
2-Fluoro-N-methylpyridin-4-amine（Cat No.:L002330）is a valuable compound in pharmaceutical research and organic synthesis. Featuring a fluorine atom and an N-methyl group on a pyridine ring, this compound is crucial as an intermediate in the synthesis of various bioactive molecules, including potential drug candidates. Its structure allows for selective reactivity and functionalization, making it an essential building block in medicinal chemistry. With high purity and consistent quality, this compound supports advanced research in drug discovery and the development of innovative therapeutic agents.
| Catalog Number | L002330 |
| CAS Number | 1564929-58-3 |
| Molecular Formula | C6H7FN2 |
| Purity | ≥95% |
| IUPAC Name | 2-fluoro-N-methylpyridin-4-amine |
| InChI | InChI=1S/C6H7FN2/c1-8-5-2-3-9-6(7)4-5/h2-4H,1H3,(H,8,9) |
| InChIKey | MUDHPAPTFFRFFY-UHFFFAOYSA-N |
| SMILES | CNC1=CC(=NC=C1)F |
