For research use only. Not for therapeutic Use.
2-Fluorobenzaldehyde (Cat.No:R023056) is an aromatic organic compound. It contains a fluorine atom and an aldehyde group attached to a benzene ring. This compound serves as a versatile building block in organic synthesis, contributing to the creation of various molecules in fields such as pharmaceuticals, agrochemicals, and materials science.
CAS Number | 446-52-6 |
Synonyms | o-Fluorobenzaldehyde; NSC 66829 |
Molecular Formula | C7H5FO |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-fluorobenzaldehyde |
InChI | InChI=1S/C7H5FO/c8-7-4-2-1-3-6(7)5-9/h1-5H |
InChIKey | ZWDVQMVZZYIAHO-UHFFFAOYSA-N |
SMILES | C1=CC=C(C(=C1)C=O)F |