For research use only. Not for therapeutic Use.
2-Fluorobenzene-1,4-diol is an aromatic compound featuring a benzene ring with a fluorine atom at the 2-position and hydroxyl groups at the 1 and 4 positions. This arrangement makes it a valuable intermediate in organic synthesis, particularly in the preparation of pharmaceuticals and agrochemicals. The presence of the hydroxyl groups contributes to its reactivity, allowing for various chemical modifications, while the fluorine substituent can enhance biological activity and influence electronic properties. Its unique structure supports diverse applications in chemical research.
CAS Number | 55660-73-6 |
Molecular Formula | C6H5FO2 |
Purity | ≥95% |
IUPAC Name | 2-fluorobenzene-1,4-diol |
InChI | InChI=1S/C6H5FO2/c7-5-3-4(8)1-2-6(5)9/h1-3,8-9H |
InChIKey | GIMXWZYFIFOCBJ-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1O)F)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |