For research use only. Not for therapeutic Use.
2-Fluorobenzylhydrazine (Cat.No:R028905) is a chemical compound used in organic synthesis. It contains a hydrazine functional group and a fluorine atom, making it useful for creating diverse molecules with specific properties. Its versatile reactivity makes it valuable in pharmaceutical and agrochemical research for the development of new compounds.
CAS Number | 51859-98-4 |
Synonyms | o-Fluorobenzyl Hydrazine; [(2-Fluorophenyl)methyl]-hydrazine |
Molecular Formula | C7H9FN2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (2-fluorophenyl)methylhydrazine |
InChI | InChI=1S/C7H9FN2/c8-7-4-2-1-3-6(7)5-10-9/h1-4,10H,5,9H2 |
InChIKey | OOMBRKGIWITBLL-UHFFFAOYSA-N |
SMILES | C1=CC=C(C(=C1)CNN)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |