For research use only. Not for therapeutic Use.
2-Fluorobenzylhydrazine (Cat.No:R028905) is a chemical compound used in organic synthesis. It contains a hydrazine functional group and a fluorine atom, making it useful for creating diverse molecules with specific properties. Its versatile reactivity makes it valuable in pharmaceutical and agrochemical research for the development of new compounds.
| Catalog Number | R028905 |
| CAS Number | 51859-98-4 |
| Synonyms | o-Fluorobenzyl Hydrazine; [(2-Fluorophenyl)methyl]-hydrazine |
| Molecular Formula | C7H9FN2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (2-fluorophenyl)methylhydrazine |
| InChI | InChI=1S/C7H9FN2/c8-7-4-2-1-3-6(7)5-10-9/h1-4,10H,5,9H2 |
| InChIKey | OOMBRKGIWITBLL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CNN)F |
