For research use only. Not for therapeutic Use.
2-Fluoronicotinic acid is a fluorinated derivative of nicotinic acid, featuring a fluorine atom at the 2-position of the pyridine ring. This compound is widely used in pharmaceutical and agrochemical research due to its ability to serve as a building block in the synthesis of bioactive molecules. The fluorine atom enhances metabolic stability and modulates biological activity, making it valuable in drug design. 2-Fluoronicotinic acid is often employed in the development of novel therapies and fine chemicals.
CAS Number | 393-55-5 |
Synonyms | 2-Fluoro-3-pyridinecarboxylic Acid; NSC 51588 |
Molecular Formula | C6H4FNO2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-fluoropyridine-3-carboxylic acid |
InChI | InChI=1S/C6H4FNO2/c7-5-4(6(9)10)2-1-3-8-5/h1-3H,(H,9,10) |
InChIKey | LLLVHTWJGWNRBD-UHFFFAOYSA-N |
SMILES | C1=CC(=C(N=C1)F)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |