(2-Fluorophenyl)methanethiol(Cat No.:L007445), is a chemical compound with the molecular formula C₇H₇FS. This compound features a phenyl ring substituted with a fluorine atom and a thiol (-SH) functional group, connected to a methylene (-CH₂-) linker. Thiols are well-known for their distinctive odor and are essential in various chemical reactions, including thiol-disulfide exchange processes. The fluorine substitution on the phenyl ring imparts unique chemical properties, making it valuable in organic synthesis, medicinal chemistry, and materials science applications.
Catalog Number | L007445 |
CAS Number | 72364-46-6 |
Molecular Formula | C7H7FS |
Purity | ≥95% |
IUPAC Name | (2-fluorophenyl)methanethiol |
InChI | InChI=1S/C7H7FS/c8-7-4-2-1-3-6(7)5-9/h1-4,9H,5H2 |
InChIKey | UMJTYEUXQGJEIZ-UHFFFAOYSA-N |
SMILES | C1=CC=C(C(=C1)CS)F |