For research use only. Not for therapeutic Use.
2-Fluoropropane-1,3-diamine(CAT: M134971) is an organic compound featuring a propane backbone with two amine groups at the 1 and 3 positions, and a fluorine atom attached to the 2-position. This structure makes it useful in medicinal and chemical research, particularly for developing new compounds with potential therapeutic applications. The fluorine atom can influence the molecule’s reactivity and biological activity, as fluorinated compounds often exhibit enhanced stability, metabolic resistance, or altered binding properties in drug design. It may also serve as an intermediate in the synthesis of more complex molecules used in pharmaceutical or agrochemical research.
CAS Number | 159029-28-4 |
Synonyms | 1,3-diamino-2-fluoropropane |
Molecular Formula | C3H9FN2 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 2-fluoropropane-1,3-diamine |
InChI | InChI=1S/C3H9FN2/c4-3(1-5)2-6/h3H,1-2,5-6H2 |
InChIKey | TXQUTKBUDACTOB-UHFFFAOYSA-N |
SMILES | C(C(CN)F)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |