For research use only. Not for therapeutic Use.
2-Formyl-5-isopropylphenylboronic acid (Cat.No:L003553) is a crucial chemical compound in organic synthesis. Its unique boronic acid functionality and formyl group make it a valuable building block for the construction of complex molecules. This compound finds extensive use in the development of pharmaceuticals and agrochemicals, showcasing its significance in the field of medicinal and agricultural chemistry.
CAS Number | 1451390-89-8 |
Molecular Formula | C10H13BO3 |
Purity | ≥95% |
IUPAC Name | (2-formyl-5-propan-2-ylphenyl)boronic acid |
InChI | InChI=1S/C10H13BO3/c1-7(2)8-3-4-9(6-12)10(5-8)11(13)14/h3-7,13-14H,1-2H3 |
InChIKey | OUMRDYQDMKOJKZ-UHFFFAOYSA-N |
SMILES | B(C1=C(C=CC(=C1)C(C)C)C=O)(O)O |