For research use only. Not for therapeutic Use.
2′-Fucosyllactose (2′-FL)（Cat No.:M015165）is a fucosylated trisaccharide composed of L-fucose, D-galactose, and D-glucose units. It is the most abundant human milk oligosaccharide (HMO), constituting approximately 30% of all HMOs. 2′-FL plays a crucial role in infant health by promoting the growth of beneficial gut bacteria, modulating the immune system, and preventing pathogen adhesion. Its benefits extend beyond infancy, contributing to overall gut health in adults. Commercial production of 2′-FL has been achieved through microbial fermentation using engineered Escherichia coli strains, enabling its inclusion in infant formulas and functional foods. Regulatory approvals in regions like the European Union and the United States have facilitated its widespread application in enhancing nutritional products.
| CAS Number | 41263-94-9 |
| Synonyms | (2R,3R,4R,5R)-4-[(2S,3R,4S,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-2,3,5,6-tetrahydroxyhexanal |
| Molecular Formula | C18H32O15 |
| Purity | ≥95% |
| IUPAC Name | (2R,3R,4R,5R)-4-[(2S,3R,4S,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-2,3,5,6-tetrahydroxyhexanal |
| InChI | InChI=1S/C18H32O15/c1-5-9(24)12(27)14(29)17(30-5)33-16-13(28)11(26)8(4-21)31-18(16)32-15(7(23)3-20)10(25)6(22)2-19/h2,5-18,20-29H,3-4H2,1H3/t5-,6-,7+,8+,9+,10+,11-,12+,13-,14-,15+,16+,17-,18-/m0/s1 |
| InChIKey | HWHQUWQCBPAQQH-BWRPKUOHSA-N |
| SMILES | C[C@H]1[C@H]([C@H]([C@@H]([C@@H](O1)O[C@@H]2[C@H]([C@H]([C@H](O[C@H]2O[C@H]([C@@H](CO)O)[C@@H]([C@H](C=O)O)O)CO)O)O)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
