For research use only. Not for therapeutic Use.
2-Hydrazino-4-methylpyrimidine hydrochloride（Cat No.:L019353）is a crucial intermediate in the synthesis of pharmaceuticals and agrochemicals. This compound, featuring a hydrazino group attached to a methylpyrimidine ring, is typically used in the development of heterocyclic compounds, particularly in the design of active pharmaceutical ingredients (APIs). The hydrochloride form enhances its stability and solubility, making it easier to handle in various synthetic processes. Its high purity and reactivity make it an indispensable reagent for researchers and chemists working on cutting-edge drug discovery and development projects.
| Catalog Number | L019353 |
| CAS Number | 1332529-53-9 |
| Molecular Formula | C5H9ClN4 |
| Purity | ≥95% |
| IUPAC Name | (4-methylpyrimidin-2-yl)hydrazine;hydrochloride |
| InChI | InChI=1S/C5H8N4.ClH/c1-4-2-3-7-5(8-4)9-6;/h2-3H,6H2,1H3,(H,7,8,9);1H |
| InChIKey | PANSVJMJTJFBBG-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NC=C1)NN.Cl |
