For research use only. Not for therapeutic Use.
2-Hydroxy-3-methyl-5-nitropyridine(Cat No.:L023917)is a heterocyclic compound used in organic synthesis and pharmaceutical research. The structure includes a hydroxyl group at the 2-position, a methyl group at the 3-position, and a nitro group at the 5-position of the pyridine ring, providing unique reactivity and functional versatility. This compound is valuable as an intermediate in the synthesis of various biologically active molecules, where the nitro group can participate in reduction or substitution reactions. Its diverse functional groups make it essential for researchers working on drug discovery and the development of novel therapeutic agents.
CAS Number | 21901-34-8 |
Molecular Formula | C6H6N2O3 |
Purity | ≥95% |
IUPAC Name | 3-methyl-5-nitro-1H-pyridin-2-one |
InChI | InChI=1S/C6H6N2O3/c1-4-2-5(8(10)11)3-7-6(4)9/h2-3H,1H3,(H,7,9) |
InChIKey | FPTYZBDNBMVYCL-UHFFFAOYSA-N |
SMILES | CC1=CC(=CNC1=O)[N+](=O)[O-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |