For research use only. Not for therapeutic Use.
2-Hydroxy-3-(trifluoromethyl)benzaldehyde(CAT: L016167) is a high-purity aromatic compound featuring a hydroxyl group and a trifluoromethyl substituent on a benzaldehyde core. This versatile molecule is widely utilized in pharmaceutical research, organic synthesis, and material science. Its unique structure makes it a critical intermediate for the development of bioactive molecules, fine chemicals, and fluorinated derivatives with enhanced pharmacokinetic properties. Known for its stability and reactivity, 2-Hydroxy-3-(trifluoromethyl)benzaldehyde supports the synthesis of complex heterocycles, ligands, and functional materials, enabling precision and efficiency in both academic and industrial applications.
CAS Number | 336628-67-2 |
Molecular Formula | C8H5F3O2 |
Purity | ≥95% |
IUPAC Name | 2-hydroxy-3-(trifluoromethyl)benzaldehyde |
InChI | InChI=1S/C8H5F3O2/c9-8(10,11)6-3-1-2-5(4-12)7(6)13/h1-4,13H |
InChIKey | ZUNOXMJBNMKYOM-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C(=C1)C(F)(F)F)O)C=O |