For research use only. Not for therapeutic Use.
2-Hydroxy-4-methyl-3-nitropyridine is a pyridine derivative featuring a hydroxyl group at the second position, a methyl group at the fourth position, and a nitro group at the third position. This compound exhibits notable reactivity and biological activity due to the presence of multiple functional groups. It is of interest in synthetic organic chemistry and may serve as a precursor for the development of pharmaceuticals, agrochemicals, and dyes. Its structure also offers opportunities for studying structure-activity relationships in medicinal chemistry.
CAS Number | 21901-18-8 |
Molecular Formula | C6H6N2O3 |
Purity | ≥95% |
IUPAC Name | 4-methyl-3-nitro-1H-pyridin-2-one |
InChI | InChI=1S/C6H6N2O3/c1-4-2-3-7-6(9)5(4)8(10)11/h2-3H,1H3,(H,7,9) |
InChIKey | HZCWTTHQRMHIIE-UHFFFAOYSA-N |
SMILES | CC1=C(C(=O)NC=C1)[N+](=O)[O-] |