For research use only. Not for therapeutic Use.
2-Hydroxy-4-phenylmethoxybenzaldehyde(Cat No.:M197210)is an important intermediate in pharmaceutical research and organic synthesis. Featuring a hydroxyl group and a phenylmethoxy group on a benzaldehyde core, this compound is essential for developing various bioactive molecules, including potential therapeutic agents. Its structure allows for selective chemical modifications, making it valuable in the synthesis of complex aromatic and heterocyclic compounds. High purity and stability ensure consistent performance in research applications, supporting advanced medicinal chemistry efforts in drug discovery and the development of innovative chemical entities.
CAS Number | 52085-14-0 |
Molecular Formula | C14H12O3 |
Purity | ≥95% |
IUPAC Name | 2-hydroxy-4-phenylmethoxybenzaldehyde |
InChI | InChI=1S/C14H12O3/c15-9-12-6-7-13(8-14(12)16)17-10-11-4-2-1-3-5-11/h1-9,16H,10H2 |
InChIKey | AMLKEDBYDOCGEG-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)COC2=CC(=C(C=C2)C=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |