For research use only. Not for therapeutic Use.
2-Hydroxy-5-methanesulfonamidobenzoic acid(Cat No.:L007352), is a key chemical compound used in pharmaceutical research and development. This molecule features a benzoic acid core with a hydroxy group at the 2-position and a methanesulfonamido (–SO2NH–CH3) group at the 5-position. Its unique structure lends itself to various medicinal applications, particularly in the field of drug discovery. Scientists leverage its properties to design and synthesize potential drug candidates, exploring its interactions with biological targets.
CAS Number | 926243-08-5 |
Molecular Formula | C8H9NO5S |
Purity | ≥95% |
IUPAC Name | 2-hydroxy-5-(methanesulfonamido)benzoic acid |
InChI | InChI=1S/C8H9NO5S/c1-15(13,14)9-5-2-3-7(10)6(4-5)8(11)12/h2-4,9-10H,1H3,(H,11,12) |
InChIKey | BLKPCFNDGFDHEM-UHFFFAOYSA-N |
SMILES | CS(=O)(=O)NC1=CC(=C(C=C1)O)C(=O)O |