For research use only. Not for therapeutic Use.
2-Hydroxy-5-nitrobenzene-1-sulfonyl chloride(Cat No.:L007569), is a chemical compound characterized by a sulfonyl chloride group attached to a benzene ring with hydroxy and nitro substituents. This unique molecular structure grants it significant reactivity and versatility in organic synthesis. Researchers use it as a key reagent in various chemical reactions, including nucleophilic substitutions and aromatic coupling reactions. Its applications extend to medicinal chemistry and materials science, where it serves as a valuable building block for the development of pharmaceuticals and specialty chemicals.
CAS Number | 1261760-59-1 |
Molecular Formula | C6H4ClNO5S |
Purity | ≥95% |
IUPAC Name | 2-hydroxy-5-nitrobenzenesulfonyl chloride |
InChI | InChI=1S/C6H4ClNO5S/c7-14(12,13)6-3-4(8(10)11)1-2-5(6)9/h1-3,9H |
InChIKey | YGZAEQDOCPIUPR-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1[N+](=O)[O-])S(=O)(=O)Cl)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |