For research use only. Not for therapeutic Use.
2-Hydroxy-5-(trifluoromethoxy)benzoic acid(Cat No.:M106258)is an aromatic compound featuring a hydroxyl group at the 2-position and a trifluoromethoxy group at the 5-position on the benzoic acid ring. This compound is commonly used as an intermediate in the synthesis of pharmaceuticals and agrochemicals. The trifluoromethoxy group enhances the compound’s lipophilicity and metabolic stability, making it valuable in the development of bioactive molecules. Its structure allows for versatile chemical modifications, making it a crucial building block in medicinal chemistry and the synthesis of advanced organic compounds.
Catalog Number | M106258 |
CAS Number | 129644-57-1 |
Molecular Formula | C8H5F3O4 |
Purity | ≥95% |
IUPAC Name | 2-hydroxy-5-(trifluoromethoxy)benzoic acid |
InChI | InChI=1S/C8H5F3O4/c9-8(10,11)15-4-1-2-6(12)5(3-4)7(13)14/h1-3,12H,(H,13,14) |
InChIKey | HNYMLXYADOZCNY-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1OC(F)(F)F)C(=O)O)O |