For research use only. Not for therapeutic Use.
2-Hydroxy-6-methylnicotinic acid is a derivative of nicotinic acid (vitamin B3) featuring a hydroxyl group (-OH) at the 2-position and a methyl group (-CH₃) at the 6-position on the pyridine ring. This compound combines the biological activity of nicotinic acid with additional functional groups that can alter its solubility and reactivity. It is used in organic synthesis, particularly in the preparation of pharmaceuticals, and has potential applications in medicinal chemistry due to its anti-inflammatory, antioxidant, or metabolic regulatory properties.
Catalog Number | M048425 |
CAS Number | 1572-97-0 |
Molecular Formula | C9H12O2 |
Purity | ≥95% |
Storage | Desiccate at +4 ℃ |
IUPAC Name | (1S)-1-(4-methoxyphenyl)ethanol |
InChI | InChI=1S/C9H12O2/c1-7(10)8-3-5-9(11-2)6-4-8/h3-7,10H,1-2H3/t7-/m0/s1 |
InChIKey | IUUULXXWNYKJSL-ZETCQYMHSA-N |
SMILES | CC(C1=CC=C(C=C1)OC)O |