For research use only. Not for therapeutic Use.
2-Hydroxy Carbamazepine is a metabolite of the anticonvulsant drug carbamazepine, used in pharmaceutical and biochemical research. It is essential for studying the pharmacokinetics, pharmacodynamics, and metabolic pathways of carbamazepine. This compound aids in understanding the drug’s mechanism of action, therapeutic efficacy, and potential side effects. Researchers rely on 2-Hydroxy Carbamazepine for precise and reliable results in advanced studies of epilepsy treatment, neuropharmacology, and drug development, contributing significantly to innovations in anticonvulsant therapy and neurological research.
| Catalog Number | R007462 |
| CAS Number | 68011-66-5 |
| Synonyms | 2-Hydroxy-5H-dibenz[b,f]azepine-5-carboxamide; |
| Molecular Formula | C15H12N2O2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 3-hydroxybenzo[b][1]benzazepine-11-carboxamide |
| InChI | InChI=1S/C15H12N2O2/c16-15(19)17-13-4-2-1-3-10(13)5-6-11-9-12(18)7-8-14(11)17/h1-9,18H,(H2,16,19) |
| InChIKey | VPZIYMMSJFWLSP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C(N2C(=O)N)C=CC(=C3)O |
