For research use only. Not for therapeutic Use.
2-Hydroxyanthracene(Cat No.:M007548) is a derivative of anthracene, a polycyclic aromatic hydrocarbon characterized by three fused benzene rings. The addition of a hydroxyl group at the 2-position on the anthracene structure introduces new chemical properties, such as increased polarity and potential for hydrogen bonding. This modification enhances its solubility in polar solvents compared to anthracene itself. 2-Hydroxyanthracene is used primarily in scientific research to study photophysical behaviors and in the synthesis of dyes and optical brighteners. It also serves as a building block in organic synthesis, particularly in the creation of complex molecular structures in materials science.
CAS Number | 613-14-9 |
Synonyms | 2-HYDROXYANTHRACENE |
Molecular Formula | C14H10O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | anthracen-2-ol |
InChI | InChI=1S/C14H10O/c15-14-6-5-12-7-10-3-1-2-4-11(10)8-13(12)9-14/h1-9,15H |
InChIKey | BQBWUVWMUXGILF-UHFFFAOYSA-N |
SMILES | C1=CC=C2C=C3C=C(C=CC3=CC2=C1)O |