For research use only. Not for therapeutic Use.
2-Hydroxybenzylamine is an organic compound with the chemical formula C7H9NO. It consists of a benzene ring attached to an amine group and a hydroxyl group at the para position. This compound is used in organic synthesis to create various derivatives and pharmaceutical compounds due to its versatile chemical structure. The hydroxyl and amine groups enable it to participate in a range of reactions, making it valuable in research and development.
CAS Number | 932-30-9 |
Synonyms | α-Amino-o-cresol; 2-(Aminomethyl)phenol; 2-Hydroxybenzenemethanamine; NSC 127870; Salicylamine; o-Hydroxybenzylamine; |
Molecular Formula | C7H9NO |
Purity | ≥95% |
Target | NF-κB |
Storage | -20°C |
IUPAC Name | 2-(aminomethyl)phenol |
InChI | InChI=1S/C7H9NO/c8-5-6-3-1-2-4-7(6)9/h1-4,9H,5,8H2 |
InChIKey | KPRZOPQOBJRYSW-UHFFFAOYSA-N |
SMILES | C1=CC=C(C(=C1)CN)O |