For research use only. Not for therapeutic Use.
2-Hydroxybut-3-enoic acid (Cat No.:M011538), also known as hydroxycrotonic acid or α-hydroxyisocaproic acid. It features a hydroxyl group and a carboxyl group attached to a but-3-enoic acid (crotonic acid) backbone. This compound is significant in biochemistry and metabolism as an intermediate in the degradation of branched-chain amino acids. It plays a role in energy production and maintaining nitrogen balance in the body. Additionally, it is used in cosmetic and personal care products for its potential benefits on skin health and hydration due to its hydroxyl group.
CAS Number | 600-17-9 |
Molecular Formula | C4H6O3 |
Purity | ≥95% |
IUPAC Name | 2-hydroxybut-3-enoic acid |
InChI | InChI=1S/C4H6O3/c1-2-3(5)4(6)7/h2-3,5H,1H2,(H,6,7) |
InChIKey | VBWPSWWDYVWZKA-UHFFFAOYSA-N |
SMILES | C=CC(C(=O)O)O |