For research use only. Not for therapeutic Use.
2-Hydroxybutanoic Acid (Cat.No:R020193), also known as alpha-hydroxybutyric acid or alpha-hydroxybutanoic acid, is a naturally occurring organic compound. It is a key intermediate in various metabolic pathways and can be found in certain foods. Additionally, it has applications in the pharmaceutical and cosmetic industries
Catalog Number | R020193 |
CAS Number | 600-15-7 |
Synonyms | (±)-2-Hydroxybutanoic Acid; DL-2-Hydroxybutyric Acid; (RS)-2-Hydroxybutyric Acid; (±)-2-Hydroxy-n-butyric Acid; (±)-2-Hydroxybutanoic Acid; (±)-2-Hydroxybutyric Acid; (±)-α-Hydroxybutyric Acid; 2-Hydroxybutanoic Acid; 2-Hydroxybutyric Acid; DL-2-Hydr |
Molecular Formula | C4H8O3 |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | -20°C |
IUPAC Name | 2-hydroxybutanoic acid |
InChI | InChI=1S/C4H8O3/c1-2-3(5)4(6)7/h3,5H,2H2,1H3,(H,6,7) |
InChIKey | AFENDNXGAFYKQO-UHFFFAOYSA-N |
SMILES | CCC(C(=O)O)O |