For research use only. Not for therapeutic Use.
2-Hydroxychalcone(Cat No.:M185554), a natural flavonoid, exhibits antioxidant properties and inhibits lipid peroxidation. It also demonstrates apoptotic effects by downregulating Bcl-2, a protein involved in inhibiting apoptosis. Additionally, 2-hydroxychalcone can inhibit the activation of NF-kB, a transcription factor involved in inflammation and immune responses. Through these mechanisms, 2-hydroxy chalcone may have potential therapeutic applications in conditions related to oxidative stress, apoptosis dysregulation, and NF-kB-mediated inflammation.
Catalog Number | M185554 |
CAS Number | 644-78-0 |
Molecular Formula | C15H12O2 |
Purity | ≥95% |
Target | NF-κB |
IUPAC Name | (E)-3-(2-hydroxyphenyl)-1-phenylprop-2-en-1-one |
InChI | InChI=1S/C15H12O2/c16-14-9-5-4-8-13(14)10-11-15(17)12-6-2-1-3-7-12/h1-11,16H/b11-10+ |
InChIKey | UDOOPSJCRMKSGL-ZHACJKMWSA-N |
SMILES | C1=CC=C(C=C1)C(=O)C=CC2=CC=CC=C2O |