For research use only. Not for therapeutic Use.
2-Hydroxycinnamic acid(Cat No.:R070062)is a naturally occurring phenolic compound widely studied for its biological and chemical properties. It serves as a precursor in the synthesis of various bioactive molecules and exhibits antioxidant, anti-inflammatory, and antimicrobial activities. This compound is valuable in pharmaceutical and biochemical research, particularly for exploring its role in cellular protection mechanisms and its potential therapeutic applications. 2-Hydroxycinnamic acid is also used in material science and food chemistry, highlighting its versatility in advancing research across multiple scientific disciplines.
CAS Number | 614-60-8 |
Synonyms | trans-o-Hydroxycinnamic acid |
Molecular Formula | C9H8O3 |
Purity | ≥95% |
Target | Metabolic Enzyme/Protease |
Storage | RT |
IUPAC Name | (E)-3-(2-hydroxyphenyl)prop-2-enoic acid |
InChI | InChI=1S/C9H8O3/c10-8-4-2-1-3-7(8)5-6-9(11)12/h1-6,10H,(H,11,12)/b6-5+ |
InChIKey | PMOWTIHVNWZYFI-AATRIKPKSA-N |
SMILES | C1=CC=C(C(=C1)/C=C/C(=O)O)O |