For research use only. Not for therapeutic Use.
2′-Hydroxydaidzein is a natural compound classified as an isoflavone, derived from daidzein. It features a hydroxyl group at the 2′ position of the daidzein molecule. This compound is found in various plants, particularly legumes such as soybeans, and is known for its potential health benefits, including antioxidant and anti-inflammatory properties. 2′-Hydroxydaidzein is studied for its role in hormone regulation and its potential in preventing chronic diseases. Research continues to explore its pharmacological activities and therapeutic applications.
CAS Number | 7678-85-5 |
Molecular Formula | C15H10O5 |
Purity | ≥95% |
Target | Plants |
Storage | Store at -20°C |
IUPAC Name | 3-(2,4-dihydroxyphenyl)-7-hydroxychromen-4-one |
InChI | InChI=1S/C15H10O5/c16-8-1-3-10(13(18)5-8)12-7-20-14-6-9(17)2-4-11(14)15(12)19/h1-7,16-18H |
InChIKey | ZCTNPCRBEWXCGP-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1O)O)C2=COC3=C(C2=O)C=CC(=C3)O |