For research use only. Not for therapeutic Use.
2-Hydroxydecanedioic acid is a hydroxylated dicarboxylic acid used in various industrial and scientific applications. Known for its role in organic synthesis and polymer production, this compound offers enhanced reactivity due to its hydroxyl group. It is also studied for its potential in pharmaceuticals and cosmetics, where its properties can improve product performance and stability.
CAS Number | 103963-71-9 |
Synonyms | α-Hydroxysebacic Acid |
Molecular Formula | C10H18O5 |
Purity | 98% |
Documentation | |
Storage | -20°C |
Related CAS | 18294-85-4 13095-47-1 13095-48-2 505-52-2 |
IUPAC Name | 2-hydroxydecanedioic acid |
InChI | InChI=1S/C10H18O5/c11-8(10(14)15)6-4-2-1-3-5-7-9(12)13/h8,11H,1-7H2,(H,12,13)(H,14,15) |
InChIKey | LPIOYESQKJFWPQ-UHFFFAOYSA-N |
SMILES | C(CCCC(C(=O)O)O)CCCC(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |