For research use only. Not for therapeutic Use.
2-hydroxymethyl benzoic acid(Cat No.:I015091) is an endogenous metabolite, meaning it is a compound naturally produced within the body. It is derived from the metabolism of other substances, such as aromatic amino acids or phenolic compounds. As an endogenous metabolite, 2-hydroxymethyl benzoic acid is involved in various biochemical processes and functions within the body. Understanding its physiological role and potential interactions can provide insights into its significance in metabolism, health, and disease pathways.
CAS Number | 612-20-4 |
Molecular Formula | C₈H₈O₃ |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | Room Temperature |
IUPAC Name | 2-(hydroxymethyl)benzoic acid |
InChI | InChI=1S/C8H8O3/c9-5-6-3-1-2-4-7(6)8(10)11/h1-4,9H,5H2,(H,10,11) |
InChIKey | MGMNPSAERQZUIM-UHFFFAOYSA-N |
SMILES | C1=CC=C(C(=C1)CO)C(=O)O |