For research use only. Not for therapeutic Use.
2-(Hydroxymethyl)isonicotinaldehyde（Cat No.:L010451）is a heterocyclic compound featuring a hydroxymethyl group at the 2-position and an aldehyde group on an isonicotinic acid backbone. This compound is valuable in pharmaceutical research and organic synthesis as an intermediate for the development of bioactive molecules, including drug candidates and agrochemicals. The hydroxymethyl group provides a reactive site for further chemical modifications, while the aldehyde group facilitates various condensation and cyclization reactions. Its structure makes it particularly useful in designing complex molecular frameworks for advanced medicinal chemistry and chemical synthesis applications.
| Catalog Number | L010451 |
| CAS Number | 1155873-00-9 |
| Molecular Formula | C7H7NO2 |
| Purity | ≥95% |
| IUPAC Name | 2-(hydroxymethyl)pyridine-4-carbaldehyde |
| InChI | InChI=1S/C7H7NO2/c9-4-6-1-2-8-7(3-6)5-10/h1-4,10H,5H2 |
| InChIKey | AROPODFXRVGCPP-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1C=O)CO |
