For research use only. Not for therapeutic Use.
2-(Hydroxymethyl)isonicotinonitrile（Cat No.:L016565）is an organic compound featuring both a hydroxymethyl group and a nitrile group attached to an isonicotinic acid derivative. It serves as an important intermediate in the synthesis of various pharmaceuticals and agrochemicals. The hydroxymethyl group increases the compound’s reactivity, allowing for further chemical modifications, while the nitrile group provides a pathway for the synthesis of more complex structures. This compound is valuable in medicinal chemistry for developing drugs that target bacterial infections, tuberculosis, or other conditions related to nicotinic acid derivatives.
| Catalog Number | L016565 |
| CAS Number | 51454-63-8 |
| Molecular Formula | C7H6N2O |
| Purity | ≥95% |
| IUPAC Name | 2-(hydroxymethyl)pyridine-4-carbonitrile |
| InChI | InChI=1S/C7H6N2O/c8-4-6-1-2-9-7(3-6)5-10/h1-3,10H,5H2 |
| InChIKey | MMVBJOBTOMJNHE-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1C#N)CO |
