For research use only. Not for therapeutic Use.
2-Hydroxyterephthalaldehyde (Cat.No:L003903) is a pivotal compound in organic synthesis. Its unique structure, incorporating a hydroxyl group and terephthalaldehyde backbone, imparts distinctive reactivity. This compound is employed as a crucial intermediate in the preparation of specialized organic molecules with various industrial and pharmaceutical applications.
CAS Number | 73289-90-4 |
Molecular Formula | C8H6O3 |
Purity | ≥95% |
IUPAC Name | 2-hydroxyterephthalaldehyde |
InChI | InChI=1S/C8H6O3/c9-4-6-1-2-7(5-10)8(11)3-6/h1-5,11H |
InChIKey | DFIOBSJHIZBUCE-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1C=O)O)C=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |