For research use only. Not for therapeutic Use.
(2-Iodo-4,5-dimethylphenyl)methanol(Cat No.:L024574)is a chemically synthesized aromatic compound featuring iodine, methyl groups, and a methanol functional group attached to a benzene ring. This compound serves as a valuable intermediate in organic synthesis, particularly useful in the preparation of various pharmaceuticals and fine chemicals through halogenation and alkylation reactions. Its iodine substituent is crucial for further functional transformations, enhancing its utility in creating more complex molecular structures. This compound is particularly important for research in areas requiring precise modifications of aromatic rings, contributing significantly to advancements in medicinal chemistry.
CAS Number | 851384-78-6 |
Molecular Formula | C9H11IO |
Purity | ≥95% |
IUPAC Name | (2-iodo-4,5-dimethylphenyl)methanol |
InChI | InChI=1S/C9H11IO/c1-6-3-8(5-11)9(10)4-7(6)2/h3-4,11H,5H2,1-2H3 |
InChIKey | OZONDJBVFLGNJH-UHFFFAOYSA-N |
SMILES | CC1=CC(=C(C=C1C)I)CO |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |