For research use only. Not for therapeutic Use.
(2-Iodo-5-methoxyphenyl)boronic Acid is a high-purity compound used in organic synthesis and medicinal chemistry. This boronic acid derivative is essential for studying Suzuki-Miyaura cross-coupling reactions and in the synthesis of complex molecules, including pharmaceuticals and agrochemicals. Its precise composition ensures reliable and reproducible results, making it indispensable for advanced chemical synthesis and drug development applications. Ideal for experimental setups, (2-Iodo-5-methoxyphenyl)boronic Acid enhances research accuracy and efficiency.
CAS Number | 89694-50-8 |
Synonyms | B-(2-Iodo-5-methoxyphenyl)-boronic Acid; 2-Iodo-5-methoxybenzeneboronic Acid |
Molecular Formula | C7H8BIO3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (2-iodo-5-methoxyphenyl)boronic acid |
InChI | InChI=1S/C7H8BIO3/c1-12-5-2-3-7(9)6(4-5)8(10)11/h2-4,10-11H,1H3 |
InChIKey | XQYAEIDOJUNIGY-UHFFFAOYSA-N |
SMILES | B(C1=C(C=CC(=C1)OC)I)(O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |