For research use only. Not for therapeutic Use.
2-Iodo-5-methylpyridine(Cat No.:L043660)is a valuable organic compound widely used in pharmaceutical and chemical research. Featuring an iodine atom and a methyl group attached to a pyridine ring, this compound serves as a key building block in the synthesis of complex molecules. Its unique structure allows for versatile chemical transformations, making it essential in the development of new drugs, agrochemicals, and advanced materials. 2-Iodo-5-methylpyridine supports high-precision synthesis, contributing significantly to advancements in medicinal chemistry and innovative organic synthesis.
Catalog Number | L043660 |
CAS Number | 22282-62-8 |
Molecular Formula | C6H6IN |
Purity | ≥95% |
IUPAC Name | 2-iodo-5-methylpyridine |
InChI | InChI=1S/C6H6IN/c1-5-2-3-6(7)8-4-5/h2-4H,1H3 |
InChIKey | XOODLNRDHSTOQJ-UHFFFAOYSA-N |
SMILES | CC1=CN=C(C=C1)I |